| Name | 9-Ethylanthracene |
|---|---|
| Synonyms | Anthracene, 9-Ethyl-; Nsc26994 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 |
| CAS Registry Number | 605-83-4 |
| SMILES | C3=C2C=C1C=CC=CC1=C(C2=CC=C3)CC |
| InChI | 1S/C16H14/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h3-11H,2H2,1H3 |
| InChIKey | ZFBBPVJBVIJQCE-UHFFFAOYSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.263°C at 760 mmHg (Cal.) |
| Flash point | 165.139°C (Cal.) |
| (1) | M. Arslan, E. Asker, J. Masnovi and R. J. Baker. 1,4-Di-9-anthrylbutane, Acta Cryst. (2007). E63, o2400-o2402 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 9-Ethylanthracene |