|
CAS#: 605-92-5 Product: 2-Amino-1-Naphthyl hydrogen sulphate No suppilers available for the product. |
| Name | 2-Amino-1-Naphthyl hydrogen sulphate |
|---|---|
| Synonyms | (2-Amino-1-Naphthyl) Hydrogen Sulfate; 2-Amino-1-Naphthyl Hydrogen Sulfate; 2-Amino-1-Naphthyl Hydrogen Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 |
| CAS Registry Number | 605-92-5 |
| SMILES | C1=C(C(=C2C(=C1)C=CC=C2)O[S](=O)(=O)O)N |
| InChI | 1S/C10H9NO4S/c11-9-6-5-7-3-1-2-4-8(7)10(9)15-16(12,13)14/h1-6H,11H2,(H,12,13,14) |
| InChIKey | WCLTXNJDYMNZDY-UHFFFAOYSA-N |
| Density | 1.575g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Amino-1-Naphthyl hydrogen sulphate |