|
CAS#: 6065-09-4 Product: 3-Nitro-3-Octene No suppilers available for the product. |
| Name | 3-Nitro-3-Octene |
|---|---|
| Synonyms | 3-Nitro-3-Octene; 3-Octene, 3-Nitro-; Brn 1841265 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 6065-09-4 |
| SMILES | C(\C([N+]([O-])=O)=C\CCCC)C |
| InChI | 1S/C8H15NO2/c1-3-5-6-7-8(4-2)9(10)11/h7H,3-6H2,1-2H3/b8-7- |
| InChIKey | WXCHLANPJRZEII-FPLPWBNLSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.283°C at 760 mmHg (Cal.) |
| Flash point | 83.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitro-3-Octene |