Online Database of Chemicals from Around the World
|
CAS#: 61202-97-9 Product: Ethyl 3-Methyl-2,4-Dioxohexanoate No suppilers available for the product. |
| Name | Ethyl 3-Methyl-2,4-Dioxohexanoate |
|---|---|
| Synonyms | 3-Methyl-2,4-Dioxohexanoic Acid Ethyl Ester; 2,4-Diketo-3-Methyl-Hexanoic Acid Ethyl Ester; Ethyl 3-Methyl-2,4-Dioxo-Hexanoate |
| Molecular Structure |  |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 61202-97-9 |
| EINECS | 262-651-9 |
| SMILES | C(OC(=O)C(=O)C(C(=O)CC)C)C |
| InChI | 1S/C9H14O4/c1-4-7(10)6(3)8(11)9(12)13-5-2/h6H,4-5H2,1-3H3 |
| InChIKey | UUDJREZGIPQANP-UHFFFAOYSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.987°C at 760 mmHg (Cal.) |
| Flash point | 101.054°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-Methyl-2,4-Dioxohexanoate |