|
CAS#: 62410-77-9 Product: (5Z,13E,15S)-9alpha,15-Dihydroxy-11-Oxoprosta-5,13-Dien-1-Oic Acid 1,9-Lactone No suppilers available for the product. |
| Name | (5Z,13E,15S)-9alpha,15-Dihydroxy-11-Oxoprosta-5,13-Dien-1-Oic Acid 1,9-Lactone |
|---|---|
| Synonyms | (Z)-7-[(1R,5R)-2-Hydroxy-5-[(E,3S)-3-Hydroxyoct-1-Enyl]-4-Keto-1-Cyclopent-2-Enyl]Hept-5-Enal; Prostaglandin E2 1,15-Lactone; Brn 5577723 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.45 |
| CAS Registry Number | 62410-77-9 (62410-93-9) |
| SMILES | [C@H]1([C@H](C(=CC1=O)O)C\C=C/CCCC=O)\C=C\[C@@H](O)CCCCC |
| InChI | 1S/C20H30O4/c1-2-3-7-10-16(22)12-13-18-17(19(23)15-20(18)24)11-8-5-4-6-9-14-21/h5,8,12-18,22-23H,2-4,6-7,9-11H2,1H3/b8-5-,13-12+/t16-,17+,18+/m0/s1 |
| InChIKey | FYHDHGVOLHUOOG-RBGINRRASA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.374°C at 760 mmHg (Cal.) |
| Flash point | 269.908°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5Z,13E,15S)-9alpha,15-Dihydroxy-11-Oxoprosta-5,13-Dien-1-Oic Acid 1,9-Lactone |