|
CAS#: 6299-21-4 Product: 4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine No suppilers available for the product. |
| Name | 4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine |
|---|---|
| Synonyms | 4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine; 4-[(2-Chlorophenyl)Methylthio]-6-Methyl-2-Pyrimidinamine; [4-[(2-Chlorobenzyl)Thio]-6-Methyl-Pyrimidin-2-Yl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12ClN3S |
| Molecular Weight | 265.76 |
| CAS Registry Number | 6299-21-4 |
| SMILES | C1=C(N=C(N=C1C)N)SCC2=C(C=CC=C2)Cl |
| InChI | 1S/C12H12ClN3S/c1-8-6-11(16-12(14)15-8)17-7-9-4-2-3-5-10(9)13/h2-6H,7H2,1H3,(H2,14,15,16) |
| InChIKey | VXEJJNKCPISIMQ-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.624°C at 760 mmHg (Cal.) |
| Flash point | 238.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine |