|
CAS#: 63019-93-2 Product: 4-(Dimethylamino)-3-Biphenylol No suppilers available for the product. |
| Name | 4-(Dimethylamino)-3-Biphenylol |
|---|---|
| Synonyms | 2-Dimethylamino-5-Phenyl-Phenol; 3-Biphenylol, 4-(Dimethylamino)-; 4-(Dimethylamino)-3-Biphenylol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 |
| CAS Registry Number | 63019-93-2 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2O)N(C)C |
| InChI | 1S/C14H15NO/c1-15(2)13-9-8-12(10-14(13)16)11-6-4-3-5-7-11/h3-10,16H,1-2H3 |
| InChIKey | ORIAIGHQLDPLDL-UHFFFAOYSA-N |
| Density | 1.116g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.382°C at 760 mmHg (Cal.) |
| Flash point | 171.029°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Dimethylamino)-3-Biphenylol |