|
CAS#: 63039-25-8 Product: Bis(Bromopropyl) Chloroethyl Phosphate No suppilers available for the product. |
| Name | Bis(Bromopropyl) Chloroethyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Bis(1-Bromopropyl) 1-Chloroethyl Ester; Bis(Bromopropyl) Chloroethyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16Br2ClO4P |
| Molecular Weight | 402.45 |
| CAS Registry Number | 63039-25-8 |
| EINECS | 263-805-8 |
| SMILES | C(C(Br)O[P](OC(Br)CC)(OC(Cl)C)=O)C |
| InChI | 1S/C8H16Br2ClO4P/c1-4-7(9)14-16(12,13-6(3)11)15-8(10)5-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | MXXNFGSAOWFTQG-UHFFFAOYSA-N |
| Density | 1.658g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.548°C at 760 mmHg (Cal.) |
| Flash point | 161.572°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Bromopropyl) Chloroethyl Phosphate |