|
CAS#: 63040-24-4 Product: 4-Amino-4'-Methoxy-3-Biphenylol No suppilers available for the product. |
| Name | 4-Amino-4'-Methoxy-3-Biphenylol |
|---|---|
| Synonyms | 3-Biphenylol, 4-Amino-4'-Methoxy-; 3-Hydroxy-4'-Methoxy-4-Aminodiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 63040-24-4 |
| SMILES | C2=C(C1=CC=C(OC)C=C1)C=CC(=C2O)N |
| InChI | 1S/C13H13NO2/c1-16-11-5-2-9(3-6-11)10-4-7-12(14)13(15)8-10/h2-8,15H,14H2,1H3 |
| InChIKey | QHBSMUCJGFWNMV-UHFFFAOYSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.561°C at 760 mmHg (Cal.) |
| Flash point | 186.981°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-4'-Methoxy-3-Biphenylol |