|
CAS#: 6317-71-1 Product: 2,5-Dibromo-3,6-Diphenyl-1,4-Dithiine No suppilers available for the product. |
| Name | 2,5-Dibromo-3,6-Diphenyl-1,4-Dithiine |
|---|---|
| Synonyms | Nsc43081 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H10Br2S2 |
| Molecular Weight | 426.18 |
| CAS Registry Number | 6317-71-1 |
| SMILES | C1=CC=CC=C1C2=C(Br)SC(=C(S2)Br)C3=CC=CC=C3 |
| InChI | 1S/C16H10Br2S2/c17-15-13(11-7-3-1-4-8-11)19-16(18)14(20-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | DHWQDUCQQYSDNT-UHFFFAOYSA-N |
| Density | 1.768g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.645°C at 760 mmHg (Cal.) |
| Flash point | 225.132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dibromo-3,6-Diphenyl-1,4-Dithiine |