|
CAS#: 63887-04-7 Product: 5-Bromo-2-Methoxy-N-Methyl-3-Phenylbenzamide No suppilers available for the product. |
| Name | 5-Bromo-2-Methoxy-N-Methyl-3-Phenylbenzamide |
|---|---|
| Synonyms | 5-Bromo-2-Methoxy-N-Methyl-3-Phenyl-Benzamide; Brn 3348616; Benzamide, 5-Bromo-2-Methoxy-N-Methyl-3-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 |
| CAS Registry Number | 63887-04-7 |
| SMILES | C1=C(C(=C(C=C1Br)C(NC)=O)OC)C2=CC=CC=C2 |
| InChI | 1S/C15H14BrNO2/c1-17-15(18)13-9-11(16)8-12(14(13)19-2)10-6-4-3-5-7-10/h3-9H,1-2H3,(H,17,18) |
| InChIKey | NGYXKOYBVFNFFH-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.664°C at 760 mmHg (Cal.) |
| Flash point | 179.181°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-2-Methoxy-N-Methyl-3-Phenylbenzamide |