|
CAS#: 63887-22-9 Product: 4-Amino-N-Cyclobutyl-3,5-Dichlorobenzamide No suppilers available for the product. |
| Name | 4-Amino-N-Cyclobutyl-3,5-Dichlorobenzamide |
|---|---|
| Synonyms | 4-Amino-3,5-Dichloro-N-Cyclobutyl-Benzamide; Benzamide, 4-Amino-N-Cyclobutyl-3,5-Dichloro-; Brn 2733393 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.13 |
| CAS Registry Number | 63887-22-9 |
| SMILES | C1=C(C(=C(C=C1C(=O)NC2CCC2)Cl)N)Cl |
| InChI | 1S/C11H12Cl2N2O/c12-8-4-6(5-9(13)10(8)14)11(16)15-7-2-1-3-7/h4-5,7H,1-3,14H2,(H,15,16) |
| InChIKey | GBPFYZSRYXJENE-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.327°C at 760 mmHg (Cal.) |
| Flash point | 172.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-N-Cyclobutyl-3,5-Dichlorobenzamide |