|
CAS#: 6662-83-5 Product: Kopsanone No suppilers available for the product. |
| Name | Kopsanone |
|---|---|
| Synonyms | Nsc340072 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 |
| CAS Registry Number | 6662-83-5 |
| SMILES | C1=CC=CC2=C1C34C7(N2)C5CC6(C3N(CC4C5=O)CCC6)CC7 |
| InChI | 1S/C20H22N2O/c23-16-13-10-18-6-3-9-22-11-14(16)20(17(18)22)12-4-1-2-5-15(12)21-19(13,20)8-7-18/h1-2,4-5,13-14,17,21H,3,6-11H2 |
| InChIKey | RFDVSXYPLPEIGZ-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.025°C at 760 mmHg (Cal.) |
| Flash point | 267.092°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Kopsanone |