|
CAS#: 67823-49-8 Product: 3-Methyl-2-Nitro-1-(2,3-Epoxypropoxy)Benzene No suppilers available for the product. |
| Name | 3-Methyl-2-Nitro-1-(2,3-Epoxypropoxy)Benzene |
|---|---|
| Synonyms | 2-[(3-Methyl-2-Nitro-Phenoxy)Methyl]Oxirane; ((3-Methyl-2-Nitrophenoxy)Methyl)Oxirane; 3-Methyl-2-Nitro-1-(2,3-Epoxypropoxy)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 67823-49-8 |
| SMILES | C2=C(OCC1OC1)C(=C(C=C2)C)[N+]([O-])=O |
| InChI | 1S/C10H11NO4/c1-7-3-2-4-9(10(7)11(12)13)15-6-8-5-14-8/h2-4,8H,5-6H2,1H3 |
| InChIKey | IYBXFWFKGBPYKO-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.955°C at 760 mmHg (Cal.) |
| Flash point | 168.742°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2-Nitro-1-(2,3-Epoxypropoxy)Benzene |