|
CAS#: 6784-25-4 Product: Diformyl Dapsone No suppilers available for the product. |
| Name | Diformyl Dapsone |
|---|---|
| Synonyms | N-[4-(4-Formamidophenyl)Sulfonylphenyl]Methanamide; 4,4'-Diformamidodiphenyl Sulfone; Dfd |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.32 |
| CAS Registry Number | 6784-25-4 |
| SMILES | C1=CC(=CC=C1[S](C2=CC=C(C=C2)NC=O)(=O)=O)NC=O |
| InChI | 1S/C14H12N2O4S/c17-9-15-11-1-5-13(6-2-11)21(19,20)14-7-3-12(4-8-14)16-10-18/h1-10H,(H,15,17)(H,16,18) |
| InChIKey | NOWADDNUCMOPLH-UHFFFAOYSA-N |
| Density | 1.44g/cm3 (Cal.) |
|---|---|
| Boiling point | 643.435°C at 760 mmHg (Cal.) |
| Flash point | 342.937°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diformyl Dapsone |