|
CAS#: 67906-36-9 Product: 1,4-Bis[(2,6-Dimethylphenyl)Amino]-6,7-Dichloroanthraquinone No suppilers available for the product. |
| Name | 1,4-Bis[(2,6-Dimethylphenyl)Amino]-6,7-Dichloroanthraquinone |
|---|---|
| Synonyms | 6,7-Dichloro-1,4-Bis[(2,6-Dimethylphenyl)Amino]-9,10-Anthraquinone; 1,4-Bis((2,6-Dimethylphenyl)Amino)-6,7-Dichloroanthraquinone; 9,10-Anthracenedione, 6,7-Dichloro-1,4-Bis((2,6-Dimethylphenyl)Amino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C30H24Cl2N2O2 |
| Molecular Weight | 515.44 |
| CAS Registry Number | 67906-36-9 |
| EINECS | 267-703-4 |
| SMILES | C1=C(C(=CC2=C1C(=O)C3=C(C2=O)C(=CC=C3NC4=C(C=CC=C4C)C)NC5=C(C=CC=C5C)C)Cl)Cl |
| InChI | 1S/C30H24Cl2N2O2/c1-15-7-5-8-16(2)27(15)33-23-11-12-24(34-28-17(3)9-6-10-18(28)4)26-25(23)29(35)19-13-21(31)22(32)14-20(19)30(26)36/h5-14,33-34H,1-4H3 |
| InChIKey | PCNWENIIFRCYSX-UHFFFAOYSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 686.012°C at 760 mmHg (Cal.) |
| Flash point | 368.687°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis[(2,6-Dimethylphenyl)Amino]-6,7-Dichloroanthraquinone |