|
CAS#: 69466-60-0 Product: 5-(3-Chlorophenyl)-3-(Methylthio)-1,2,4-Triazine No suppilers available for the product. |
| Name | 5-(3-Chlorophenyl)-3-(Methylthio)-1,2,4-Triazine |
|---|---|
| Synonyms | 5-(3-Chlorophenyl)-3-(Methylthio)-1,2,4-Triazine; 1,2,4-Triazine, 5-(3-Chlorophenyl)-3-(Methylthio)-; 5-(M-Chlorophenyl)-3-(Methylthio)-As-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8ClN3S |
| Molecular Weight | 237.71 |
| CAS Registry Number | 69466-60-0 |
| SMILES | C1=C(N=C(N=N1)SC)C2=CC=CC(=C2)Cl |
| InChI | 1S/C10H8ClN3S/c1-15-10-13-9(6-12-14-10)7-3-2-4-8(11)5-7/h2-6H,1H3 |
| InChIKey | VZWLMFMRSUDPAQ-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.885°C at 760 mmHg (Cal.) |
| Flash point | 218.625°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-Chlorophenyl)-3-(Methylthio)-1,2,4-Triazine |