Online Database of Chemicals from Around the World
|
CAS#: 7000-79-5 Product: 1,3,5,7-Tetramethyl-2,4,6,8-Tetrathiaadamantane No suppilers available for the product. |
| Name | 1,3,5,7-Tetramethyl-2,4,6,8-Tetrathiaadamantane |
|---|---|
| Synonyms | 2,4,6,8-Tetrathiaadamantane, 1,3,5,7-Tetramethyl-; 2,4,6,8-Tetrathiatricyclo[3.3.1.1(3,7)]Decane, 1,3,5,7-Tetramethyl- |
| Molecular Structure |  |
| Molecular Formula | C10H16S4 |
| Molecular Weight | 264.48 |
| CAS Registry Number | 7000-79-5 |
| SMILES | CC12CC3(C)SC(S1)(CC(S2)(S3)C)C |
| InChI | 1S/C10H16S4/c1-7-5-8(2)13-9(3,11-7)6-10(4,12-7)14-8/h5-6H2,1-4H3 |
| InChIKey | HUWTULKGEASRFA-UHFFFAOYSA-N |
| Density | 1.347g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.999°C at 760 mmHg (Cal.) |
| Flash point | 183.531°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5,7-Tetramethyl-2,4,6,8-Tetrathiaadamantane |