|
CAS#: 70166-48-2 Product: Pyroxyfur No suppilers available for the product. |
| Name | Pyroxyfur |
|---|---|
| Synonyms | 2-Chloro-6-(2-Furylmethoxy)-4-(Trichloromethyl)Pyridine; 2-Chloro-6-(2-Furanylmethoxy)-4-(Trichloromethyl)Pyridine; Caswell No. 528Aa |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7Cl4NO2 |
| Molecular Weight | 326.99 |
| CAS Registry Number | 70166-48-2 |
| SMILES | C1=C(C=C(N=C1Cl)OCC2=CC=CO2)C(Cl)(Cl)Cl |
| InChI | 1S/C11H7Cl4NO2/c12-9-4-7(11(13,14)15)5-10(16-9)18-6-8-2-1-3-17-8/h1-5H,6H2 |
| InChIKey | OGBSAJWRIPNIER-UHFFFAOYSA-N |
| Density | 1.532g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.469°C at 760 mmHg (Cal.) |
| Flash point | 192.368°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyroxyfur |