|
CAS#: 7021-52-5 Product: 6-Methylthiopurine Ribonucleoside-5'-Phosphate No suppilers available for the product. |
| Name | 6-Methylthiopurine Ribonucleoside-5'-Phosphate |
|---|---|
| Synonyms | [(2R,3S,4R,5R)-3,4-Dihydroxy-5-(2-Methyl-6-Thioxo-3H-Purin-9-Yl)Tetrahydrofuran-2-Yl]Methyl Dihydrogen Phosphate; [(2R,3S,4R,5R)-3,4-Dihydroxy-5-(2-Methyl-6-Thioxo-3H-Purin-9-Yl)-2-Tetrahydrofuranyl]Methyl Dihydrogen Phosphate; 6-(Methylthio)-9-Beta-D-Ribofuranosyl-9H-Purine 5'-(Dihydrogen Phosphate) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N4O7PS |
| Molecular Weight | 378.30 |
| CAS Registry Number | 7021-52-5 |
| SMILES | [C@H]1(O)[C@@H](O[C@@H]([C@H]1O)CO[P](O)(O)=O)[N]2C3=C(N=C2)C(=S)N=C(N3)C |
| InChI | 1S/C11H15N4O7PS/c1-4-13-9-6(10(24)14-4)12-3-15(9)11-8(17)7(16)5(22-11)2-21-23(18,19)20/h3,5,7-8,11,16-17H,2H2,1H3,(H,13,14,24)(H2,18,19,20)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | JZBDJXVVRLSRDO-IOSLPCCCSA-N |
| Density | 2.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 811.092°C at 760 mmHg (Cal.) |
| Flash point | 444.332°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methylthiopurine Ribonucleoside-5'-Phosphate |