|
CAS#: 7071-89-8 Product: Fluoren-2,5-Ylenediamine No suppilers available for the product. |
| Name | Fluoren-2,5-Ylenediamine |
|---|---|
| Synonyms | (7-Amino-9H-Fluoren-4-Yl)Amine; 2,5-Fluorenediamine; Fluorene-2,5-Diamine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 |
| CAS Registry Number | 7071-89-8 |
| EINECS | 230-365-3 |
| SMILES | C1=CC(=CC3=C1C2=C(N)C=CC=C2C3)N |
| InChI | 1S/C13H12N2/c14-10-4-5-11-9(7-10)6-8-2-1-3-12(15)13(8)11/h1-5,7H,6,14-15H2 |
| InChIKey | RRLKPKUPGAXIQP-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.021°C at 760 mmHg (Cal.) |
| Flash point | 283.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Fluoren-2,5-Ylenediamine |