|
CAS#: 71436-83-4 Product: 1-(4-Butoxyphenyl)-2-(1-piperidinyl)-1-propanone No suppilers available for the product. |
| Name | 1-(4-Butoxyphenyl)-2-(1-piperidinyl)-1-propanone |
|---|---|
| Synonyms | 4'-butoxy-2-piperidinopropiophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.41 |
| CAS Registry Number | 71436-83-4 |
| EINECS | 275-442-2 |
| SMILES | CC(C(=O)c1ccc(OCCCC)cc1)N2CCCCC2 |
| InChI | 1S/C18H27NO2/c1-3-4-14-21-17-10-8-16(9-11-17)18(20)15(2)19-12-6-5-7-13-19/h8-11,15H,3-7,12-14H2,1-2H3 |
| InChIKey | GTVLVUISDRKFTD-UHFFFAOYSA-N |
| Density | 1.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.716°C at 760 mmHg (Cal.) |
| Flash point | 207.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Butoxyphenyl)-2-(1-piperidinyl)-1-propanone |