|
CAS#: 71712-70-4 Product: 2-Nitro-3,7,8-Trichlorodibenzo-4-Dioxin No suppilers available for the product. |
| Name | 2-Nitro-3,7,8-Trichlorodibenzo-4-Dioxin |
|---|---|
| Synonyms | 2,3,7-Trichloro-8-Nitro-Oxanthrene; Oprea1_690515; 2-Nitro-3,7,8-Trichlorodibenzo-4-Dioxin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Cl3NO4 |
| Molecular Weight | 332.53 |
| CAS Registry Number | 71712-70-4 |
| SMILES | C1=C([N+](=O)[O-])C(=CC2=C1OC3=C(O2)C=C(Cl)C(=C3)Cl)Cl |
| InChI | 1S/C12H4Cl3NO4/c13-5-1-9-10(2-6(5)14)20-12-4-8(16(17)18)7(15)3-11(12)19-9/h1-4H |
| InChIKey | GOPUMYRJSKUMAN-UHFFFAOYSA-N |
| Density | 1.698g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.487°C at 760 mmHg (Cal.) |
| Flash point | 232.295°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-3,7,8-Trichlorodibenzo-4-Dioxin |