|
CAS#: 71762-36-2 Product: [(Dimethylphosphinoyl)Methyl]Phosphonic Acid No suppilers available for the product. |
| Name | [(Dimethylphosphinoyl)Methyl]Phosphonic Acid |
|---|---|
| Synonyms | ((Dimethylphosphinoyl)Methyl)Phosphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C3H10O4P2 |
| Molecular Weight | 172.06 |
| CAS Registry Number | 71762-36-2 |
| EINECS | 275-991-8 |
| SMILES | C([P](=O)(O)O)[P](=O)(C)C |
| InChI | 1S/C3H10O4P2/c1-8(2,4)3-9(5,6)7/h3H2,1-2H3,(H2,5,6,7) |
| InChIKey | OPQAGLVVRDQXPB-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.437°C at 760 mmHg (Cal.) |
| Flash point | 237.102°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(Dimethylphosphinoyl)Methyl]Phosphonic Acid |