|
CAS#: 73663-91-9 Product: Ethyl (E)-3-Ethylsulfonylprop-2-Enoate No suppilers available for the product. |
| Name | Ethyl (E)-3-Ethylsulfonylprop-2-Enoate |
|---|---|
| Synonyms | (E)-3-Ethylsulfonylprop-2-Enoic Acid Ethyl Ester; (E)-3-Ethylsulfonylacrylic Acid Ethyl Ester; 3-(Ethylsulfonyl)Acrylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.23 |
| CAS Registry Number | 73663-91-9 |
| SMILES | C([S](\C=C\C(OCC)=O)(=O)=O)C |
| InChI | 1S/C7H12O4S/c1-3-11-7(8)5-6-12(9,10)4-2/h5-6H,3-4H2,1-2H3/b6-5+ |
| InChIKey | SRVCCYWDCDXZFY-AATRIKPKSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.897°C at 760 mmHg (Cal.) |
| Flash point | 154.526°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (E)-3-Ethylsulfonylprop-2-Enoate |