|
CAS#: 73688-89-8 Product: 5,6-Dichloro-2-(4-Methylsulfanylphenyl)-1,3,2-Benzodioxaborole No suppilers available for the product. |
| Name | 5,6-Dichloro-2-(4-Methylsulfanylphenyl)-1,3,2-Benzodioxaborole |
|---|---|
| Synonyms | 5,6-Dichloro-2-[4-(Methylthio)Phenyl]-1,3,2-Benzodioxaborole; Nsc 221144; 1,2-(4,5-Dichlorophenylene) P-Methylthiobenzeneboronate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9BCl2O2S |
| Molecular Weight | 310.99 |
| CAS Registry Number | 73688-89-8 |
| SMILES | C2=C1OB(OC1=CC(=C2Cl)Cl)C3=CC=C(SC)C=C3 |
| InChI | 1S/C13H9BCl2O2S/c1-19-9-4-2-8(3-5-9)14-17-12-6-10(15)11(16)7-13(12)18-14/h2-7H,1H3 |
| InChIKey | LOXGENMEUVNPAU-UHFFFAOYSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.811°C at 760 mmHg (Cal.) |
| Flash point | 203.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dichloro-2-(4-Methylsulfanylphenyl)-1,3,2-Benzodioxaborole |