|
CAS#: 73713-81-2 Product: 6-Methyl-2,3-dihydro-2-phenyl-1H-1,3,2-benzothiazaphosphole-2-sulfide No suppilers available for the product. |
| Name | 6-Methyl-2,3-dihydro-2-phenyl-1H-1,3,2-benzothiazaphosphole-2-sulfide |
|---|---|
| Synonyms | 4-Methyl-8-Phenyl-8-Thioxo-7-Thia-9-Aza-8$L^{5}-Phosphabicyclo[4.3.0]Nona-1(6),2,4-Triene; 1,3,2-Benzothiazaphosphole, 2,3-Dihydro-6-Methyl-2-Phenyl-, 2-Sulfide; 1,3,2-Benzothiazaphospholine, 6-Methyl-2-Phenyl-, 2-Sulfide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12NPS2 |
| Molecular Weight | 277.34 |
| CAS Registry Number | 73713-81-2 |
| SMILES | C2=C1S[P](=S)(NC1=CC=C2C)C3=CC=CC=C3 |
| InChI | 1S/C13H12NPS2/c1-10-7-8-12-13(9-10)17-15(16,14-12)11-5-3-2-4-6-11/h2-9H,1H3,(H,14,16) |
| InChIKey | SGNNWCGXIXCYNI-UHFFFAOYSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.815°C at 760 mmHg (Cal.) |
| Flash point | 217.373°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-2,3-dihydro-2-phenyl-1H-1,3,2-benzothiazaphosphole-2-sulfide |