|
CAS#: 73747-33-8 Product: 8-Cyclopentyloxy-1,3,7-Trimethylpurine-2,6-Dione No suppilers available for the product. |
| Name | 8-Cyclopentyloxy-1,3,7-Trimethylpurine-2,6-Dione |
|---|---|
| Synonyms | 8-(Cyclopentoxy)-1,3,7-Trimethyl-Purine-2,6-Dione; 8-(Cyclopentoxy)-1,3,7-Trimethylpurine-2,6-Dione; 8-(Cyclopentoxy)-1,3,7-Trimethyl-Xanthine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 |
| CAS Registry Number | 73747-33-8 |
| SMILES | CN3C1=C([N](C(=N1)OC2CCCC2)C)C(N(C3=O)C)=O |
| InChI | 1S/C13H18N4O3/c1-15-9-10(16(2)13(19)17(3)11(9)18)14-12(15)20-8-6-4-5-7-8/h8H,4-7H2,1-3H3 |
| InChIKey | DBMKBAZKDMFYLG-UHFFFAOYSA-N |
| Density | 1.45g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.959°C at 760 mmHg (Cal.) |
| Flash point | 232.58°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Cyclopentyloxy-1,3,7-Trimethylpurine-2,6-Dione |