|
CAS#: 73747-35-0 Product: 1,3,7-Trimethyl-8-(3-Methylbutylsulfanyl)Purine-2,6-Dione No suppilers available for the product. |
| Name | 1,3,7-Trimethyl-8-(3-Methylbutylsulfanyl)Purine-2,6-Dione |
|---|---|
| Synonyms | 8-Isopentylsulfanyl-1,3,7-Trimethyl-Purine-2,6-Dione; 8-(Isopentylthio)-1,3,7-Trimethylpurine-2,6-Dione; 8-(Isoamylthio)-1,3,7-Trimethyl-Xanthine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.39 |
| CAS Registry Number | 73747-35-0 |
| SMILES | C(SC1=NC2=C([N]1C)C(N(C(N2C)=O)C)=O)CC(C)C |
| InChI | 1S/C13H20N4O2S/c1-8(2)6-7-20-12-14-10-9(15(12)3)11(18)17(5)13(19)16(10)4/h8H,6-7H2,1-5H3 |
| InChIKey | MGAOAMZOLCYPSY-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.181°C at 760 mmHg (Cal.) |
| Flash point | 236.343°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,7-Trimethyl-8-(3-Methylbutylsulfanyl)Purine-2,6-Dione |