|
CAS#: 73758-25-5 Product: 1,1-Dideuterio-1-(2,3,4,5,6-Pentadeuteriophenyl)Propan-2-Amine No suppilers available for the product. |
| Name | 1,1-Dideuterio-1-(2,3,4,5,6-Pentadeuteriophenyl)Propan-2-Amine |
|---|---|
| Synonyms | [2,2-Dideuterio-1-Methyl-2-(2,3,4,5,6-Pentadeuteriophenyl)Ethyl]Amine; Amphetamine-D7; Brn 2847736 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6D7N |
| Molecular Weight | 142.25 |
| CAS Registry Number | 73758-25-5 |
| SMILES | C1(=C(C(=C(C(=C1[2H])C(C(C)N)([2H])[2H])[2H])[2H])[2H])[2H] |
| InChI | 1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/i2D,3D,4D,5D,6D,7D2 |
| InChIKey | KWTSXDURSIMDCE-XDLMLWIYSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 201.499°C at 760 mmHg (Cal.) |
| Flash point | 87.385°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Dideuterio-1-(2,3,4,5,6-Pentadeuteriophenyl)Propan-2-Amine |