|
CAS#: 73791-13-6 Product: 3-(3,4-Dimethylphenyl)-2-Hydroxychromen-4-One No suppilers available for the product. |
| Name | 3-(3,4-Dimethylphenyl)-2-Hydroxychromen-4-One |
|---|---|
| Synonyms | 3-(3,4-Dimethylphenyl)-2-Hydroxy-Chromen-4-One; 3-(3,4-Dimethylphenyl)-2-Hydroxy-4-Chromenone; 3-(3,4-Dimethylphenyl)-2-Hydroxy-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 73791-13-6 |
| SMILES | C3=C(C2=C(OC1=CC=CC=C1C2=O)O)C=CC(=C3C)C |
| InChI | 1S/C17H14O3/c1-10-7-8-12(9-11(10)2)15-16(18)13-5-3-4-6-14(13)20-17(15)19/h3-9,19H,1-2H3 |
| InChIKey | KYRSCZZYQPHKHW-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.959°C at 760 mmHg (Cal.) |
| Flash point | 156.477°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,4-Dimethylphenyl)-2-Hydroxychromen-4-One |