|
CAS#: 73928-08-2 Product: Carbanilic Acid Spiro[2.4]Heptan-4-Yl Ester No suppilers available for the product. |
| Name | Carbanilic Acid Spiro[2.4]Heptan-4-Yl Ester |
|---|---|
| Synonyms | N-Phenylcarbamic Acid 4-Spiro[2.4]Heptanyl Ester; N-Phenylcarbamic Acid Spiro[2.4]Heptan-4-Yl Ester; Nsc 87815 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 |
| CAS Registry Number | 73928-08-2 |
| SMILES | C3=C(NC(OC2C1(CC1)CCC2)=O)C=CC=C3 |
| InChI | 1S/C14H17NO2/c16-13(15-11-5-2-1-3-6-11)17-12-7-4-8-14(12)9-10-14/h1-3,5-6,12H,4,7-10H2,(H,15,16) |
| InChIKey | MHTOTGKLDPSBIU-UHFFFAOYSA-N |
| Density | 1.18g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.214°C at 760 mmHg (Cal.) |
| Flash point | 146.856°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carbanilic Acid Spiro[2.4]Heptan-4-Yl Ester |