|
CAS#: 74039-20-6 Product: 5-Chloro-2,4-Difluoro-6-Trifluoromethylpyrimidine No suppilers available for the product. |
| Name | 5-Chloro-2,4-Difluoro-6-Trifluoromethylpyrimidine |
|---|---|
| Synonyms | 5-Chloro-2,4-Difluoro-6-Trifluoromethylpyrimidine; Pyrimidine, 5-Chloro-2,4-Difluoro-6-Trifluoromethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C5ClF5N2 |
| Molecular Weight | 218.51 |
| CAS Registry Number | 74039-20-6 |
| SMILES | C1(=NC(=C(C(=N1)F)Cl)C(F)(F)F)F |
| InChI | 1S/C5ClF5N2/c6-1-2(5(9,10)11)12-4(8)13-3(1)7 |
| InChIKey | LTRDQYKIIGULAQ-UHFFFAOYSA-N |
| Density | 1.684g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.639°C at 760 mmHg (Cal.) |
| Flash point | 101.754°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2,4-Difluoro-6-Trifluoromethylpyrimidine |