|
CAS#: 74039-35-3 Product: 1-(3-Chloro-alpha-Ethylbenzyl)-Pyrrolidine Hydrochloride No suppilers available for the product. |
| Name | 1-(3-Chloro-alpha-Ethylbenzyl)-Pyrrolidine Hydrochloride |
|---|---|
| Synonyms | 1-(1-(M-Chlorophenyl)Propyl)Pyrrolidine Hydrochloride; H 186-M; Pyrrolidine, 1-(M-Chloro-Alpha-Ethylbenzyl)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19Cl2N |
| Molecular Weight | 260.21 |
| CAS Registry Number | 74039-35-3 |
| SMILES | [H+].C1=C(Cl)C=CC=C1C(N2CCCC2)CC.[Cl-] |
| InChI | 1S/C13H18ClN.ClH/c1-2-13(15-8-3-4-9-15)11-6-5-7-12(14)10-11;/h5-7,10,13H,2-4,8-9H2,1H3;1H |
| InChIKey | PKQPKOROCNUQSC-UHFFFAOYSA-N |
| Boiling point | 279.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 122.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Chloro-alpha-Ethylbenzyl)-Pyrrolidine Hydrochloride |