|
CAS#: 74306-00-6 Product: Isovaleric Acid 2-(p-Bromophenyl)Hydrazide No suppilers available for the product. |
| Name | Isovaleric Acid 2-(p-Bromophenyl)Hydrazide |
|---|---|
| Synonyms | N'-(4-Bromophenyl)-3-Methyl-Butanehydrazide; N'-(4-Bromophenyl)-3-Methyl-Butyrohydrazide; Brn 5009110 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 |
| CAS Registry Number | 74306-00-6 |
| SMILES | C1=C(NNC(CC(C)C)=O)C=CC(=C1)Br |
| InChI | 1S/C11H15BrN2O/c1-8(2)7-11(15)14-13-10-5-3-9(12)4-6-10/h3-6,8,13H,7H2,1-2H3,(H,14,15) |
| InChIKey | UCGFWLWQVLRSCI-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.146°C at 760 mmHg (Cal.) |
| Flash point | 140.767°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isovaleric Acid 2-(p-Bromophenyl)Hydrazide |