|
CAS#: 74332-62-0 Product: N,N-Diethylbenzene-1,4-Diamine Sulfite No suppilers available for the product. |
| Name | N,N-Diethylbenzene-1,4-Diamine Sulfite |
|---|---|
| Synonyms | (4-Aminophenyl)-Diethyl-Amine Sulfite; 4-Amino-N,N-Diethylaniline Sulphite |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.31 |
| CAS Registry Number | 74332-62-0 |
| EINECS | 277-821-8 |
| SMILES | O=[S]([O-])[O-].C1=C(N(CC)CC)C=CC(=C1)N |
| InChI | 1S/C10H16N2.H2O3S/c1-3-12(4-2)10-7-5-9(11)6-8-10;1-4(2)3/h5-8H,3-4,11H2,1-2H3;(H2,1,2,3)/p-2 |
| InChIKey | FULOTKQZFAERET-UHFFFAOYSA-L |
| Boiling point | 261°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 108.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethylbenzene-1,4-Diamine Sulfite |