|
CAS#: 74417-09-7 Product: 5-(3-Chlorophenyl)-3-Ethoxy-1,2,4-Triazine No suppilers available for the product. |
| Name | 5-(3-Chlorophenyl)-3-Ethoxy-1,2,4-Triazine |
|---|---|
| Synonyms | As-Triazine, 5-(M-Chlorophenyl)-3-Ethoxy-; 1,2,4-Triazine, 5-(M-Chlorophenyl)-3-Ethoxy-; 5-(M-Chlorophenyl)-3-Ethoxy-As-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10ClN3O |
| Molecular Weight | 235.67 |
| CAS Registry Number | 74417-09-7 |
| SMILES | C1=C(N=C(N=N1)OCC)C2=CC=CC(=C2)Cl |
| InChI | 1S/C11H10ClN3O/c1-2-16-11-14-10(7-13-15-11)8-4-3-5-9(12)6-8/h3-7H,2H2,1H3 |
| InChIKey | ZDPNHZDRBBDUKE-UHFFFAOYSA-N |
| Density | 1.261g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.188°C at 760 mmHg (Cal.) |
| Flash point | 194.013°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-Chlorophenyl)-3-Ethoxy-1,2,4-Triazine |