|
CAS#: 74437-39-1 Product: 6-Phenylbicyclo[2.2.1]Hepta-2,5-Diene No suppilers available for the product. |
| Name | 6-Phenylbicyclo[2.2.1]Hepta-2,5-Diene |
|---|---|
| Synonyms | Bicyclo(2.2.1)Hepta-2,5-Diene, 2-Phenyl-; 2-Phenylbicyclo[2.2.1]Hepta-2,5-Diene; Bicyclo[2.2.1]Hepta-2,5-Diene, 2-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12 |
| Molecular Weight | 168.24 |
| CAS Registry Number | 74437-39-1 |
| SMILES | C1=C(C=CC=C1)C2=CC3CC2C=C3 |
| InChI | 1S/C13H12/c1-2-4-11(5-3-1)13-9-10-6-7-12(13)8-10/h1-7,9-10,12H,8H2 |
| InChIKey | YAICWJNVEOOIEM-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.176°C at 760 mmHg (Cal.) |
| Flash point | 104.639°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Phenylbicyclo[2.2.1]Hepta-2,5-Diene |