|
CAS#: 7470-16-8 Product: 6-Methoxyphenanthren-9-Amine No suppilers available for the product. |
| Name | 6-Methoxyphenanthren-9-Amine |
|---|---|
| Synonyms | 6-Methoxy-9-Phenanthrenamine; (6-Methoxy-9-Phenanthryl)Amine; Nsc402376 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 |
| CAS Registry Number | 7470-16-8 |
| SMILES | C1=C(OC)C=CC3=C1C2=C(C=CC=C2)C=C3N |
| InChI | 1S/C15H13NO/c1-17-11-6-7-13-14(9-11)12-5-3-2-4-10(12)8-15(13)16/h2-9H,16H2,1H3 |
| InChIKey | BILXUJZPYLFSOK-UHFFFAOYSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.737°C at 760 mmHg (Cal.) |
| Flash point | 243.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxyphenanthren-9-Amine |