|
CAS#: 7550-03-0 Product: Ethyl 4-Fluorophenylglycolate No suppilers available for the product. |
| Name | Ethyl 4-Fluorophenylglycolate |
|---|---|
| Synonyms | Ethyl 2-(4-Fluorophenyl)-2-Hydroxy-Acetate; 2-(4-Fluorophenyl)-2-Hydroxyacetic Acid Ethyl Ester; 2-(4-Fluorophenyl)-2-Hydroxy-Acetic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.19 |
| CAS Registry Number | 7550-03-0 |
| EINECS | 231-438-2 |
| SMILES | C1=C(C(C(=O)OCC)O)C=CC(=C1)F |
| InChI | 1S/C10H11FO3/c1-2-14-10(13)9(12)7-3-5-8(11)6-4-7/h3-6,9,12H,2H2,1H3 |
| InChIKey | CNCGHQKCIUHNRW-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.506°C at 760 mmHg (Cal.) |
| Flash point | 125.865°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-Fluorophenylglycolate |