| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Name | Perfluoro-N-Methyl-N,N-Diethylamine |
|---|---|
| Synonyms | Bis(1,1,2,2,2-Pentafluoroethyl)-(Trifluoromethyl)Amine; Perfluoromethyldiethylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C5F13N |
| Molecular Weight | 321.04 |
| CAS Registry Number | 758-48-5 |
| SMILES | FC(F)(F)N(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | 1S/C5F13N/c6-1(7,8)3(12,13)19(5(16,17)18)4(14,15)2(9,10)11 |
| InChIKey | KMPITNDOTGKQSE-UHFFFAOYSA-N |
| Density | 1.695g/cm3 (Cal.) |
|---|---|
| Boiling point | 45.184°C at 760 mmHg (Cal.) |
| Flash point | -18.872°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Perfluoro-N-Methyl-N,N-Diethylamine |