|
CAS#: 77349-48-5 Product: 2-Dimethylaminoethyl-1,10-Dimethyl-2,7-Dihydrotetraphyllinate No suppilers available for the product. |
| Name | 2-Dimethylaminoethyl-1,10-Dimethyl-2,7-Dihydrotetraphyllinate |
|---|---|
| Synonyms | Oxayohimban-16-Carboxylic Acid, 2,7-Dihydro-16,17-Didehydro-11-Methoxy-1,10,19-Trimethyl-, 2-(Dimethylamino)Ethyl Ester, (19-Alpha)- |
| Molecular Structure | ![]() |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.62 |
| CAS Registry Number | 77349-48-5 |
| SMILES | [C@H]13N(C[C@H]2[C@H](C1)C(=CO[C@H]2C)C(OCCN(C)C)=O)CCC4C3N(C5=CC(=C(C=C45)C)OC)C |
| InChI | 1S/C27H39N3O4/c1-16-11-20-18-7-8-30-14-21-17(2)34-15-22(27(31)33-10-9-28(3)4)19(21)12-24(30)26(18)29(5)23(20)13-25(16)32-6/h11,13,15,17-19,21,24,26H,7-10,12,14H2,1-6H3/t17-,18?,19-,21+,24-,26?/m0/s1 |
| InChIKey | OCEZQAKLFRJFJP-KPBRILKDSA-N |
| Density | 1.214g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.949°C at 760 mmHg (Cal.) |
| Flash point | 310.59°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Dimethylaminoethyl-1,10-Dimethyl-2,7-Dihydrotetraphyllinate |