|
CAS#: 77529-04-5 Product: (2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methanamine Hydrochloride No suppilers available for the product. |
| Name | (2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methanamine Hydrochloride |
|---|---|
| Synonyms | (2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methylamine Hydrochloride; 4,5,6,7-Tetrahydro-2-Methyl-5-Benzothiazolemethanamine Hydrochloride; 5-Benzothiazolemethanamine, 4,5,6,7-Tetrahydro-2-Methyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15ClN2S |
| Molecular Weight | 218.74 |
| CAS Registry Number | 77529-04-5 |
| SMILES | [H+].C(N)C2CC1=C(SC(=N1)C)CC2.[Cl-] |
| InChI | 1S/C9H14N2S.ClH/c1-6-11-8-4-7(5-10)2-3-9(8)12-6;/h7H,2-5,10H2,1H3;1H |
| InChIKey | LQIKWVILAGBYPD-UHFFFAOYSA-N |
| Boiling point | 308.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 140.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Methyl-4,5,6,7-Tetrahydro-1,3-Benzothiazol-5-Yl)Methanamine Hydrochloride |