|
CAS#: 78144-37-3 Product: 3,3-Diethyl-1-[(4-Methylpiperazin-1-Yl)Methyl]Pyridine-2,4-Dione No suppilers available for the product. |
| Name | 3,3-Diethyl-1-[(4-Methylpiperazin-1-Yl)Methyl]Pyridine-2,4-Dione |
|---|---|
| Synonyms | 3,3-Diethyl-1-[(4-Methyl-1-Piperazinyl)Methyl]Pyridine-2,4-Dione; 3,3-Diethyl-1-[(4-Methylpiperazin-1-Yl)Methyl]Pyridine-2,4-Quinone; 2,4(1H,3H)-Pyridinedione, 3,3-Diethyl-1-(Methylpiperazine)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 |
| CAS Registry Number | 78144-37-3 |
| SMILES | C(N1C(C(C(C=C1)=O)(CC)CC)=O)N2CCN(CC2)C |
| InChI | 1S/C15H25N3O2/c1-4-15(5-2)13(19)6-7-18(14(15)20)12-17-10-8-16(3)9-11-17/h6-7H,4-5,8-12H2,1-3H3 |
| InChIKey | DJKGBMOJHLFNOU-UHFFFAOYSA-N |
| Density | 1.076g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.604°C at 760 mmHg (Cal.) |
| Flash point | 177.822°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Diethyl-1-[(4-Methylpiperazin-1-Yl)Methyl]Pyridine-2,4-Dione |