|
CAS#: 78982-40-8 Product: 9-Methylfuro[2,3-h]Chromen-2-One No suppilers available for the product. |
| Name | 9-Methylfuro[2,3-h]Chromen-2-One |
|---|---|
| Synonyms | 9-Methyl-2-Furo[2,3-H]Chromenone; 2H-Furo(2,3-H)-1-Benzopyran-2-One, 9-Methyl-; 4'-Methylangelicin |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 78982-40-8 |
| SMILES | C3=C(C)C2=C1OC(C=CC1=CC=C2O3)=O |
| InChI | 1S/C12H8O3/c1-7-6-14-9-4-2-8-3-5-10(13)15-12(8)11(7)9/h2-6H,1H3 |
| InChIKey | NHOICFAHZSXGJY-UHFFFAOYSA-N |
| Density | 1.332g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.541°C at 760 mmHg (Cal.) |
| Flash point | 184.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Methylfuro[2,3-h]Chromen-2-One |