|
CAS#: 78984-93-7 Product: 1-(2-Phenyltetrazol-5-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(2-Phenyltetrazol-5-Yl)Ethanone |
|---|---|
| Synonyms | 1-(2-Phenyl-5-Tetrazolyl)Ethanone; 1-(2-Phenyl-1,2,3,4-Tetrazol-5-Yl)Ethanone; Nsc43558 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 |
| CAS Registry Number | 78984-93-7 |
| SMILES | C1=CC=CC=C1[N]2N=C(N=N2)C(C)=O |
| InChI | 1S/C9H8N4O/c1-7(14)9-10-12-13(11-9)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | BELYVCVZCKOIGD-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.215°C at 760 mmHg (Cal.) |
| Flash point | 173.466°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Phenyltetrazol-5-Yl)Ethanone |