|
CAS#: 80251-33-8 Product: 4-(beta-Amidinoethenyl)phenyl-4-guanidinobenzoate No suppilers available for the product. |
| Name | 4-(beta-Amidinoethenyl)phenyl-4-guanidinobenzoate |
|---|---|
| Synonyms | [4-[(E)-3-Amino-3-Imino-Prop-1-Enyl]Phenyl] 4-Guanidinobenzoate; Methanesulfonic Acid; 4-Guanidinobenzoic Acid [4-[(E)-3-Amino-3-Iminoprop-1-Enyl]Phenyl] Ester; Methanesulfonic Acid; 4-Guanidinobenzoic Acid [4-[(E)-3-Amino-3-Imino-Prop-1-Enyl]Phenyl] Ester; Methanesulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H25N5O8S2 |
| Molecular Weight | 515.56 |
| CAS Registry Number | 80251-33-8 |
| SMILES | C[S](O)(=O)=O.C[S](O)(=O)=O.C2=C(OC(=O)C1=CC=C(N=C(N)N)C=C1)C=CC(=C2)\C=C\C(N)=N |
| InChI | 1S/C17H17N5O2.2CH4O3S/c18-15(19)10-3-11-1-8-14(9-2-11)24-16(23)12-4-6-13(7-5-12)22-17(20)21;2*1-5(2,3)4/h1-10H,(H3,18,19)(H4,20,21,22);2*1H3,(H,2,3,4)/b10-3+;; |
| InChIKey | QTBJWZSUWMMLLD-PRAOPCELSA-N |
| Boiling point | 591.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 311.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(beta-Amidinoethenyl)phenyl-4-guanidinobenzoate |