Online Database of Chemicals from Around the World
|
CAS#: 81252-13-3 Product: 2-Chloro-N-(2-oxotetrahydrothiophen-3-yl)pyridine-3-carboxamide No suppilers available for the product. |
| Name | 2-Chloro-N-(2-oxotetrahydrothiophen-3-yl)pyridine-3-carboxamide |
|---|---|
| Synonyms | 2-Chloro-N-(2-Oxotetrahydrothiophen-3-Yl)Pyridine-3-Carboxamide; 2-Chloro-N-(2-Oxo-3-Tetrahydrothiophenyl)-3-Pyridinecarboxamide; 2-Chloro-N-(2-Ketotetrahydrothiophen-3-Yl)Nicotinamide |
| Molecular Structure |  |
| Molecular Formula | C10H9ClN2O2S |
| Molecular Weight | 256.71 |
| CAS Registry Number | 81252-13-3 |
| SMILES | C1=C(C(=NC=C1)Cl)C(=O)NC2C(SCC2)=O |
| InChI | 1S/C10H9ClN2O2S/c11-8-6(2-1-4-12-8)9(14)13-7-3-5-16-10(7)15/h1-2,4,7H,3,5H2,(H,13,14) |
| InChIKey | WWXCKILLMYVPCO-UHFFFAOYSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.922°C at 760 mmHg (Cal.) |
| Flash point | 266.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-N-(2-oxotetrahydrothiophen-3-yl)pyridine-3-carboxamide |