|
CAS#: 81718-70-9 Product: 6-Chloro-N,N,3-Trimethyl-Benzofuran-2-Carboxamide No suppilers available for the product. |
| Name | 6-Chloro-N,N,3-Trimethyl-Benzofuran-2-Carboxamide |
|---|---|
| Synonyms | 6-Chloro-N,N,3-Trimethyl-Benzofuran-2-Carboxamide; 6-Chloro-N,N,3-Trimethyl-2-Benzofurancarboxamide; 2-Benzofurancarboxamide, 6-Chloro-N,N,3-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 |
| CAS Registry Number | 81718-70-9 |
| SMILES | C2=C1C(=C(OC1=CC(=C2)Cl)C(=O)N(C)C)C |
| InChI | 1S/C12H12ClNO2/c1-7-9-5-4-8(13)6-10(9)16-11(7)12(15)14(2)3/h4-6H,1-3H3 |
| InChIKey | CWTLMJCGGPCOLQ-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.02°C at 760 mmHg (Cal.) |
| Flash point | 187.864°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-N,N,3-Trimethyl-Benzofuran-2-Carboxamide |