|
CAS#: 81786-33-6 Product: 1,4:3,6-Dianhydro-2-Deoxy-2-(1-Piperidinyl)-L-Iditol 5-Nitrate Monohydrochloride No suppilers available for the product. |
| Name | 1,4:3,6-Dianhydro-2-Deoxy-2-(1-Piperidinyl)-L-Iditol 5-Nitrate Monohydrochloride |
|---|---|
| Synonyms | [(3S,3Ar,6S,6As)-3-(1-Piperidyl)-2,3,3A,5,6,6A-Hexahydrofuro[4,5-B]Furan-6-Yl] Nitrate Hydrochloride; Nitric Acid [(3S,3Ar,6S,6As)-3-(1-Piperidyl)-2,3,3A,5,6,6A-Hexahydrofuro[4,5-B]Furan-6-Yl] Ester Hydrochloride; Nitric Acid [(3S,3Ar,6S,6As)-3-Piperidino-2,3,3A,5,6,6A-Hexahydrofuro[4,5-B]Furan-6-Yl] Ester Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19ClN2O5 |
| Molecular Weight | 294.73 |
| CAS Registry Number | 81786-33-6 |
| SMILES | [C@H]12OC[C@H](O[N+]([O-])=O)[C@H]1OC[C@@H]2N3CCCCC3.[H+].[Cl-] |
| InChI | 1S/C11H18N2O5.ClH/c14-13(15)18-9-7-17-10-8(6-16-11(9)10)12-4-2-1-3-5-12;/h8-11H,1-7H2;1H/t8-,9-,10+,11+;/m0./s1 |
| InChIKey | IUZAWYVGUAUKAY-PPEDPUOKSA-N |
| Boiling point | 366.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 175.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4:3,6-Dianhydro-2-Deoxy-2-(1-Piperidinyl)-L-Iditol 5-Nitrate Monohydrochloride |